For research use only. Not for therapeutic Use.
2-Amino-3-hydroxybenzaldehyde(Cat No.:L031757)is an aromatic aldehyde featuring an amino group at the 2-position and a hydroxyl group at the 3-position on the benzene ring. This compound is widely used in pharmaceutical and chemical research as a versatile intermediate in the synthesis of bioactive molecules, including potential therapeutic agents. Its dual functional groups allow for diverse chemical transformations, making it valuable in developing complex organic compounds. 2-Amino-3-hydroxybenzaldehyde is essential for researchers focused on innovative medicinal chemistry and the synthesis of novel drugs.
CAS Number | 1004545-97-4 |
Molecular Formula | C7H7NO2 |
Purity | ≥95% |
IUPAC Name | 2-amino-3-hydroxybenzaldehyde |
InChI | InChI=1S/C7H7NO2/c8-7-5(4-9)2-1-3-6(7)10/h1-4,10H,8H2 |
InChIKey | TZTQYDXLYLAILR-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C(=C1)O)N)C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |