For research use only. Not for therapeutic Use.
2-Amino-3-hydroxypyridine(CAT: R006852) is a high-purity heterocyclic compound featuring both amino and hydroxyl functional groups on a pyridine ring. This versatile molecule is widely utilized in pharmaceutical and chemical research, particularly in the synthesis of bioactive compounds and complex organic frameworks. Its dual functionality makes it an excellent candidate for exploring novel reaction pathways in medicinal chemistry and material science. With consistent quality and reliable performance, 2-Amino-3-hydroxypyridine is a valuable reagent for advancing drug discovery, organic synthesis, and innovative research applications.
CAS Number | 16867-03-1 |
Synonyms | 2-Amino-3-pyridinol; |
Molecular Formula | C5H6N2O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-aminopyridin-3-ol |
InChI | InChI=1S/C5H6N2O/c6-5-4(8)2-1-3-7-5/h1-3,8H,(H2,6,7) |
InChIKey | BMTSZVZQNMNPCT-UHFFFAOYSA-N |
SMILES | C1=CC(=C(N=C1)N)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |