For research use only. Not for therapeutic Use.
2-Amino-3-methyl-3H-imidazo[4,5-f]quinoline (Cat No.:R020507) is a chemical compound. It features an imidazoquinoline core substituted with an amino group and a methyl group. This compound holds significance in medicinal and pharmaceutical chemistry due to its potential biological activities and interactions with biological targets. Its structural features make it a candidate for drug discovery, as it could potentially influence cellular processes. The compound’s role in research contributes to understanding the effects of imidazoquinoline derivatives on biological systems, with potential implications for developing therapeutic agents for various medical conditions.
CAS Number | 76180-96-6 |
Synonyms | 3-Methyl-3H-imidazo[4,5-f]quinolin-2-amine; IQ; |
Molecular Formula | C11H10N4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3-methylimidazo[4,5-f]quinolin-2-amine |
InChI | InChI=1S/C11H10N4/c1-15-9-5-4-8-7(3-2-6-13-8)10(9)14-11(15)12/h2-6H,1H3,(H2,12,14) |
InChIKey | ARZWATDYIYAUTA-UHFFFAOYSA-N |
SMILES | CN1C2=C(C3=C(C=C2)N=CC=C3)N=C1N |