For research use only. Not for therapeutic Use.
2-Amino-3,4-dimethyl-3H-imidazo[4,5-f]quinoline is a high-purity compound essential for advanced pharmaceutical and biochemical research. This heterocyclic aromatic amine is crucial for studies involving mutagenicity, carcinogenesis, and DNA interactions. Known for its stability and bioactivity, it integrates seamlessly into experimental protocols, providing reliable and consistent results for high-precision investigations in diverse scientific applications.
Catalog Number | R020483 |
CAS Number | 77094-11-2 |
Synonyms | MeIQ; |
Molecular Formula | C12H12N4 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 3,4-dimethylimidazo[4,5-f]quinolin-2-amine |
InChI | InChI=1S/C12H12N4/c1-7-6-9-8(4-3-5-14-9)10-11(7)16(2)12(13)15-10/h3-6H,1-2H3,(H2,13,15) |
InChIKey | GMGWMIJIGUYNAY-UHFFFAOYSA-N |
SMILES | CC1=CC2=C(C=CC=N2)C3=C1N(C(=N3)N)C |