For research use only. Not for therapeutic Use.
2-Amino-3,5-dichlorobenzoic Acid (Cat. No: R019007) is an aromatic acid compound that can be used as a pharmaceutical intermediate for the preparation of chemical raw materials, mainly for scientific research.
CAS Number | 2789-92-6 |
Synonyms | 2-Amino-3,5-dichlorobenzoic acid; 3,5-Dichloro-2-aminobenzoic acid; 3,5-Dichloroanthranilic acid; NSC 1116 |
Molecular Formula | C7H5Cl2NO2 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 2-amino-3,5-dichlorobenzoic acid |
InChI | InChI=1S/C7H5Cl2NO2/c8-3-1-4(7(11)12)6(10)5(9)2-3/h1-2H,10H2,(H,11,12) |
InChIKey | KTHTXLUIEAIGCD-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C(=C1Cl)N)C(=O)O)Cl |