For research use only. Not for therapeutic Use.
2-Amino-3,5-dimethylbenzoic acid is an aromatic amino acid characterized by an amino group at the 2-position and two methyl groups at the 3 and 5 positions of the benzoic acid ring. This structure enhances its solubility and reactivity, making it valuable in organic synthesis and medicinal chemistry. The amino group can participate in various reactions, including peptide formation, while the methyl groups may influence its biological activity and pharmacokinetics. This compound is of interest for potential applications in pharmaceuticals and biochemical research.
CAS Number | 14438-32-5 |
Molecular Formula | C9H11NO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-amino-3,5-dimethylbenzoic acid |
InChI | InChI=1S/C9H11NO2/c1-5-3-6(2)8(10)7(4-5)9(11)12/h3-4H,10H2,1-2H3,(H,11,12) |
InChIKey | GIMYRAQQQBFFFJ-UHFFFAOYSA-N |
SMILES | CC1=CC(=C(C(=C1)C(=O)O)N)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |