For research use only. Not for therapeutic Use.
2-Amino-4-bromo-3-fluoro-5-iodobenzamide (Cat.No:L003667) is a significant chemical compound in pharmaceutical research. Its unique structure combines bromine, fluorine, and iodine atoms, making it a promising scaffold for drug development. This compound’s distinct properties hold potential for the synthesis of novel pharmaceutical agents.
CAS Number | 2241721-73-1 |
Molecular Formula | C7H5BrFIN2O |
Purity | ≥95% |
IUPAC Name | 2-amino-4-bromo-3-fluoro-5-iodobenzamide |
InChI | InChI=1S/C7H5BrFIN2O/c8-4-3(10)1-2(7(12)13)6(11)5(4)9/h1H,11H2,(H2,12,13) |
InChIKey | UGGBZCUXUAIHRO-UHFFFAOYSA-N |
SMILES | C1=C(C(=C(C(=C1I)Br)F)N)C(=O)N |