For research use only. Not for therapeutic Use.
2-Amino-4-bromo-5-chloro-3-fluorobenzoic acid(CAT: L022880) is a halogenated aromatic compound featuring amino and carboxylic acid functional groups, making it a valuable intermediate in pharmaceutical and chemical research. Its unique structure, with bromine, chlorine, and fluorine substituents on a benzoic acid backbone, offers versatility in the synthesis of bioactive molecules and specialty chemicals. This compound is particularly useful for drug discovery, enabling the development of complex therapeutic agents and structure-activity relationship (SAR) studies. With high purity and reliable performance, 2-Amino-4-bromo-5-chloro-3-fluorobenzoic acid supports advanced research in medicinal chemistry and organic synthesis.
CAS Number | 1698027-17-6 |
Molecular Formula | C7H4BrClFNO2 |
Purity | ≥95% |
IUPAC Name | 2-amino-4-bromo-5-chloro-3-fluorobenzoic acid |
InChI | InChI=1S/C7H4BrClFNO2/c8-4-3(9)1-2(7(12)13)6(11)5(4)10/h1H,11H2,(H,12,13) |
InChIKey | HDKYIPMDJJVHHA-UHFFFAOYSA-N |
SMILES | C1=C(C(=C(C(=C1Cl)Br)F)N)C(=O)O |