For research use only. Not for therapeutic Use.
2-Amino-4-chlorobenzoic Acid (Cat.No:R020032) is a chemical compound used in organic synthesis and pharmaceutical research. It serves as a key building block in the production of various molecules with potential pharmacological applications. Its structural versatility makes it valuable for creating diverse compounds for drug discovery and development.
CAS Number | 89-77-0 |
Synonyms | 4-Chloroanthranilic Acid; 2-Amino-4-chlorobenzoic Acid; 4-Chloro-2-aminobenzoic Acid; 4-Chloroanthranilic Acid; NSC 17188 |
Molecular Formula | C7H6ClNO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-amino-4-chlorobenzoic acid |
InChI | InChI=1S/C7H6ClNO2/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3H,9H2,(H,10,11) |
InChIKey | JYYLQSCZISREGY-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1Cl)N)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |