For research use only. Not for therapeutic Use.
2-Amino-4-hydroxybenzothiazole(Cat No.:L019144)is a key compound in pharmaceutical research and organic synthesis, featuring an amino group and a hydroxyl group on a benzothiazole ring. This versatile molecule is essential for developing various bioactive compounds, including potential therapeutic agents and dyes. Its structure allows for diverse chemical modifications, making it valuable in the synthesis of complex heterocyclic compounds. With high purity and consistent quality, 2-Amino-4-hydroxybenzothiazole supports advanced research in medicinal chemistry, aiding in the discovery and development of innovative drugs and fine chemicals.
CAS Number | 7471-03-6 |
Molecular Formula | C7H6N2OS |
Purity | ≥95% |
IUPAC Name | 2-amino-1,3-benzothiazol-4-ol |
InChI | InChI=1S/C7H6N2OS/c8-7-9-6-4(10)2-1-3-5(6)11-7/h1-3,10H,(H2,8,9) |
InChIKey | PFQJPSASUCHKRO-UHFFFAOYSA-N |
SMILES | C1=CC(=C2C(=C1)SC(=N2)N)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |