For research use only. Not for therapeutic Use.
2-Amino-4-(hydroxymethyl)phenol is an organic compound characterized by a phenolic structure with an amino group (-NH₂) at the second position and a hydroxymethyl group (-CH₂OH) at the fourth position. Its chemical formula is C₇H₉N₁O₂. This compound is notable for its potential applications in medicinal chemistry, including its use as an intermediate in the synthesis of various pharmaceuticals and dyes. The presence of both amino and hydroxymethyl groups enhances its reactivity, making it valuable for diverse chemical transformations and biological studies.
CAS Number | 52820-13-0 |
Molecular Formula | C7H9NO2 |
Purity | ≥95% |
IUPAC Name | 2-amino-4-(hydroxymethyl)phenol |
InChI | InChI=1S/C7H9NO2/c8-6-3-5(4-9)1-2-7(6)10/h1-3,9-10H,4,8H2 |
InChIKey | NGYKCAMDGXRBNP-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1CO)N)O |