For research use only. Not for therapeutic Use.
2-Amino-4-methoxynicotinonitrile is an important heterocyclic compound used in pharmaceutical research and organic synthesis. This nitrile derivative features a nicotinic structure that contributes to its biological activity. It serves as a building block for synthesizing various pharmaceuticals, particularly in the development of compounds with potential anti-inflammatory and anti-cancer properties. The unique properties of 2-Amino-4-methoxynicotinonitrile make it a valuable intermediate in medicinal chemistry, facilitating the exploration of new therapeutic agents with enhanced efficacy and specificity.
Catalog Number | R039406 |
CAS Number | 98651-70-8 |
Molecular Formula | C7H7N3O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-amino-4-methoxypyridine-3-carbonitrile |
InChI | InChI=1S/C7H7N3O/c1-11-6-2-3-10-7(9)5(6)4-8/h2-3H,1H3,(H2,9,10) |
InChIKey | ULYBLKYAFIOZRK-UHFFFAOYSA-N |
SMILES | COC1=C(C(=NC=C1)N)C#N |