For research use only. Not for therapeutic Use.
2-Amino-4,7-dioxo-1,8-dihydropteridine-6-carboxylic Acid(Cat No.:M092490) is a crucial intermediate in the biosynthesis of pteridines, compounds involved in various biological processes. This molecule is particularly important in the study of enzyme-catalyzed reactions related to folate and biopterin metabolism. Its high purity and stability make it valuable for biochemical research, including investigations into genetic disorders and enzyme deficiencies. 2-Amino-4,7-dioxo-1,8-dihydropteridine-6-carboxylic Acid supports the development of therapeutic strategies and diagnostic tools for diseases linked to pteridine metabolism, contributing significantly to advancements in medical and pharmaceutical sciences.
CAS Number | 3254-85-1 |
Synonyms | 2-amino-4,7-dioxo-1,8-dihydropteridine-6-carboxylic acid; |
Molecular Formula | C7H5N5O4 |
Purity | ≥95% |
IUPAC Name | 2-amino-4,7-dioxo-3,8-dihydropteridine-6-carboxylic acid |
InChI | InChI=1S/C7H5N5O4/c8-7-11-3-1(4(13)12-7)9-2(6(15)16)5(14)10-3/h(H,15,16)(H4,8,10,11,12,13,14) |
InChIKey | WFICTSPBINOLJT-UHFFFAOYSA-N |
SMILES | C12=C(NC(=O)C(=N1)C(=O)O)N=C(NC2=O)N |