For research use only. Not for therapeutic Use.
2-Amino-5-bromo-4-chlorobenzaldehyde(Cat No.:L020062)is an aromatic compound with the molecular formula C7H5BrClNO. It features a benzene ring substituted with amino, bromo, chloro, and aldehyde groups, offering diverse reactivity for synthetic applications. This compound is primarily used as an intermediate in the manufacture of dyes, pharmaceuticals, and other organic molecules. Its aldehyde group is particularly reactive in condensation reactions, while the amino group facilitates nucleophilic substitution. The presence of halogens makes it a versatile precursor in halogenation reactions, crucial for developing compounds with specific biological or chemical properties.
CAS Number | 1036757-11-5 |
Molecular Formula | C7H5BrClNO |
Purity | ≥95% |
IUPAC Name | 2-amino-5-bromo-4-chlorobenzaldehyde |
InChI | InChI=1S/C7H5BrClNO/c8-5-1-4(3-11)7(10)2-6(5)9/h1-3H,10H2 |
InChIKey | PROWVWALAHUEHK-UHFFFAOYSA-N |
SMILES | C1=C(C(=CC(=C1Br)Cl)N)C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |