For research use only. Not for therapeutic Use.
2-amino-5-bromo-N,3-dimethylbenzamide(CAT: L000285) is a compound with significance in organic and pharmaceutical chemistry. This chemical serves as an important intermediate in the synthesis of pharmaceutical compounds. Its action method involves serving as a key building block in the development of drug candidates, particularly in the context of drug discovery and development. Additionally, in organic chemistry, it plays a role in the synthesis of various organic compounds.
CAS Number | 890707-30-9 |
Molecular Formula | C9H11BrN2O |
Purity | ≥95% |
IUPAC Name | 2-amino-5-bromo-N,3-dimethylbenzamide |
InChI | InChI=1S/C9H11BrN2O/c1-5-3-6(10)4-7(8(5)11)9(13)12-2/h3-4H,11H2,1-2H3,(H,12,13) |
InChIKey | KGZYALLFLANLBU-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |