For research use only. Not for therapeutic Use.
2-Amino-5-bromonicotinonitrile is an organic compound consisting of a nicotinonitrile (pyridine-3-carbaldehyde nitrile) core with an amino group at the 2-position and a bromine atom at the 5-position. The amino and nitrile groups enhance its reactivity, making it useful as a precursor in organic synthesis. This compound can be employed in the synthesis of bioactive molecules, pharmaceuticals, and agrochemicals. The bromine atom, along with the nitrile group, also offers potential for further functionalization in various chemical reactions.
CAS Number | 709652-82-4 |
Molecular Formula | C6H4BrN3 |
Purity | ≥95% |
IUPAC Name | 2-amino-5-bromopyridine-3-carbonitrile |
InChI | InChI=1S/C6H4BrN3/c7-5-1-4(2-8)6(9)10-3-5/h1,3H,(H2,9,10) |
InChIKey | UJKZMLZIIIGCMI-UHFFFAOYSA-N |