For research use only. Not for therapeutic Use.
2-Amino-5-chlorobenzyl alcohol(Cat No.:L017234)is a versatile intermediate in organic synthesis, particularly useful in the pharmaceutical and chemical industries. The compound’s amino and hydroxyl groups allow for diverse chemical reactions, making it a valuable building block for creating complex molecules, including potential drug candidates. The chlorine substituent enhances its reactivity, enabling further functionalization and fine-tuning of biological activity. Researchers utilize this high-purity compound in the development of new therapeutic agents and in the exploration of innovative synthetic routes in medicinal chemistry and materials science.
CAS Number | 37585-25-4 |
Molecular Formula | C7H8ClNO |
Purity | ≥95% |
IUPAC Name | (2-amino-5-chlorophenyl)methanol |
InChI | InChI=1S/C7H8ClNO/c8-6-1-2-7(9)5(3-6)4-10/h1-3,10H,4,9H2 |
InChIKey | CLKBZWDZDVOIGJ-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1Cl)CO)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |