For research use only. Not for therapeutic Use.
2-Amino-5-(difluoromethoxy)-3-methylbenzoic acid(CAT: L000040) is a chemical compound with potential applications in pharmaceutical and organic chemistry. This compound is known for its structural attributes, which make it valuable as an intermediate for the synthesis of various organic compounds. Its specific structure, featuring amino and difluoromethoxy functional groups, provides opportunities for creating specialized molecules with potential applications in different areas of organic chemistry.
CAS Number | 1434631-73-8 |
Molecular Formula | C9H9F2NO3 |
Purity | ≥95% |
IUPAC Name | 2-amino-5-(difluoromethoxy)-3-methylbenzoic acid |
InChI | InChI=1S/C9H9F2NO3/c1-4-2-5(15-9(10)11)3-6(7(4)12)8(13)14/h2-3,9H,12H2,1H3,(H,13,14) |
InChIKey | LCDMISORVOXIMA-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |