For research use only. Not for therapeutic Use.
2-Amino-5-ethylbenzonitrile(Cat No.:L007617), is a chemical compound featuring a benzonitrile ring substituted with an amino group at the 2-position and an ethyl group at the 5-position. This specific molecular structure is significant in organic synthesis and medicinal chemistry. Researchers utilize it as a building block to create diverse organic molecules, especially in the development of pharmaceuticals. Its versatility allows for various chemical modifications, making it a valuable intermediate for the synthesis of complex compounds.
CAS Number | 79689-41-1 |
Molecular Formula | C9H10N2 |
Purity | ≥95% |
IUPAC Name | 2-amino-5-ethylbenzonitrile |
InChI | InChI=1S/C9H10N2/c1-2-7-3-4-9(11)8(5-7)6-10/h3-5H,2,11H2,1H3 |
InChIKey | XMRIHDJOLPUODW-UHFFFAOYSA-N |
SMILES | CCC1=CC(=C(C=C1)N)C#N |