For research use only. Not for therapeutic Use.
2-Amino-5-nitro-2’-chlorobenzophenone is an organic compound used in chemical synthesis and pharmaceutical research. It serves as a key intermediate in the production of various biologically active molecules and pharmaceuticals. This compound is essential for studying chemical reaction mechanisms and developing new synthetic methodologies. Researchers rely on 2-Amino-5-nitro-2’-chlorobenzophenone for precise and reliable results in advanced organic chemistry and drug development, contributing significantly to innovations in medicinal chemistry and the synthesis of therapeutic agents.
CAS Number | 2011-66-7 |
Synonyms | 2-Amino-2’-chloro-5-nitrobenzophenone; (2-Amino-5-nitrophenyl)-(2-chlorophenyl)methanone; USP Clonazepam Related Compound B; |
Molecular Formula | C13H9ClN2O3 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | (2-amino-5-nitrophenyl)-(2-chlorophenyl)methanone |
InChI | InChI=1S/C13H9ClN2O3/c14-11-4-2-1-3-9(11)13(17)10-7-8(16(18)19)5-6-12(10)15/h1-7H,15H2 |
InChIKey | GRDGBWVSVMLKBV-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)C(=O)C2=C(C=CC(=C2)[N+](=O)[O-])N)Cl |