For research use only. Not for therapeutic Use.
2-Amino-5-nitrobenzaldehyde is an organic compound containing a benzene ring with an amino group (-NH₂) at the 2-position, a nitro group (-NO₂) at the 5-position, and an aldehyde group (-CHO) at the 1-position. The amino and nitro groups provide both electron-donating and electron-withdrawing effects, respectively, while the aldehyde group offers reactivity for further chemical modifications. This compound is useful as an intermediate in organic synthesis, particularly for developing pharmaceuticals, dyes, and other bioactive molecules.
| Catalog Number | L022033 |
| CAS Number | 56008-61-8 |
| Molecular Formula | C7H6N2O3 |
| Purity | ≥95% |
| IUPAC Name | 2-amino-5-nitrobenzaldehyde |
| InChI | InChI=1S/C7H6N2O3/c8-7-2-1-6(9(11)12)3-5(7)4-10/h1-4H,8H2 |
| InChIKey | BXXBQHFYNFGHNG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])C=O)N |
