For research use only. Not for therapeutic Use.
2-Amino-5-phenylthiophene-3-carbonitrile(Cat No.:L007227), is a chemical compound with the molecular formula C11H8N2S. It consists of a thiophene ring—a five-membered sulfur-containing aromatic ring—substituted with an amino group at the 2nd position, a phenyl group at the 5th position, and a cyano group at the 3rd position. This compound is significant in organic synthesis and medicinal chemistry research. Its unique structure and functional groups make it valuable for designing molecules with potential biological activities. Researchers utilize 2-Amino-5-phenylthiophene-3-carbonitrile as a key intermediate, enabling the creation of diverse organic compounds, and contributing to drug discovery efforts and advancements in medicinal chemistry research.
CAS Number | 60271-29-6 |
Molecular Formula | C11H8N2S |
Purity | ≥95% |
IUPAC Name | 2-amino-5-phenylthiophene-3-carbonitrile |
InChI | InChI=1S/C11H8N2S/c12-7-9-6-10(14-11(9)13)8-4-2-1-3-5-8/h1-6H,13H2 |
InChIKey | WEAZGHUZIQFNLY-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C2=CC(=C(S2)N)C#N |