For research use only. Not for therapeutic Use.
2-Amino-6-bromopyridine-3-carboxylic acid(Cat No.:M026286) is an organic compound characterized by its heterocyclic structure containing a pyridine ring. This compound is notable for having three distinct functional groups: an amino group (-NH2) at the 2-position, a bromine atom attached at the 6-position, and a carboxylic acid group (-COOH) at the 3-position. The bromine atom makes this compound useful in various chemical synthesis processes, particularly in pharmaceuticals, as it can facilitate further functionalization. Its properties are valuable in the development of drug molecules, where specificity and reactivity are crucial.
CAS Number | 1196157-51-3 |
Molecular Formula | C6H5BrN2O2 |
Purity | ≥95% |
IUPAC Name | 2-amino-6-bromopyridine-3-carboxylic acid |
InChI | InChI=1S/C6H5BrN2O2/c7-4-2-1-3(6(10)11)5(8)9-4/h1-2H,(H2,8,9)(H,10,11) |
InChIKey | FGOAIGICMNFDHG-UHFFFAOYSA-N |
SMILES | C1=CC(=NC(=C1C(=O)O)N)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |