For research use only. Not for therapeutic Use.
2-Amino-6-chloro-benzothiazole-4-carboxylic acid methyl ester(CAT: L013254) is a key intermediate in pharmaceutical and chemical synthesis, particularly in the development of benzothiazole-based compounds. Its structure, featuring a benzothiazole core with a chlorine atom at the 6-position, an amino group at the 2-position, and a methyl ester functionality, makes it suitable for various chemical modifications. This compound is often used in the synthesis of biologically active molecules, including potential anti-cancer, anti-inflammatory, and antimicrobial agents. Its role in medicinal chemistry highlights its importance for research into new therapeutic compounds.
CAS Number | 1023531-08-9 |
Molecular Formula | C9H7ClN2O2S |
Purity | ≥95% |
IUPAC Name | methyl 2-amino-6-chloro-1,3-benzothiazole-4-carboxylate |
InChI | InChI=1S/C9H7ClN2O2S/c1-14-8(13)5-2-4(10)3-6-7(5)12-9(11)15-6/h2-3H,1H3,(H2,11,12) |
InChIKey | BMLKUJDKRBSLQO-UHFFFAOYSA-N |