For research use only. Not for therapeutic Use.
2-Amino-6-chlorobenzothiazole (Cat.No:R065263) is a chemical compound with diverse applications in pharmaceutical and chemical industries. It serves as a key intermediate in the synthesis of various organic compounds, including dyes, pigments, and pharmaceuticals. Its versatile reactivity makes it a valuable building block in chemical synthesis processes.
| Catalog Number | R065263 |
| CAS Number | 95-24-9 |
| Molecular Formula | C7H5ClN2S |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 6-chloro-1,3-benzothiazol-2-amine |
| InChI | InChI=1S/C7H5ClN2S/c8-4-1-2-5-6(3-4)11-7(9)10-5/h1-3H,(H2,9,10) |
| InChIKey | VMNXKIDUTPOHPO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)SC(=N2)N |
