For research use only. Not for therapeutic Use.
(2-Amino-6-chlorophenyl)methanol is an organic compound featuring a benzene ring with an amino group at the 2-position, a chlorine atom at the 6-position, and a hydroxymethyl group attached to the benzene ring. This compound serves as a versatile intermediate in organic synthesis, particularly in the development of pharmaceuticals and bioactive molecules. The presence of both amino and hydroxyl groups offers sites for further functionalization, making it valuable in creating diverse chemical structures. Researchers employ (2-Amino-6-chlorophenyl)methanol in medicinal chemistry to synthesize new compounds with potential therapeutic applications, such as anti-inflammatory or antimicrobial agents.
| Catalog Number | R072954 |
| CAS Number | 39885-08-0 |
| Molecular Formula | C7H8ClNO |
| Purity | ≥95% |
| IUPAC Name | (2-amino-6-chlorophenyl)methanol |
| InChI | InChI=1S/C7H8ClNO/c8-6-2-1-3-7(9)5(6)4-10/h1-3,10H,4,9H2 |
| InChIKey | YKQICINWSAISBB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)CO)N |
