For research use only. Not for therapeutic Use.
2-Amino-6-mercaptopurine-9-D-riboside Hydrate(Cat No.:R003043), also known as tioguanine or 6-thioguanine, is a medication used in the treatment of certain types of leukemia. It works by interfering with the growth and spread of cancer cells in the body. Tioguanine is classified as an antimetabolite and is similar in structure to the DNA building blocks adenine and guanine. This similarity allows it to disrupt the synthesis of DNA and RNA in cancer cells, ultimately leading to their death.
CAS Number | 85-31-4 |
Synonyms | 2-Amino-9-β-D-ribofuranosyl-9H-purine-6-thiol; Thioguanosine; NSC-29422; 2-Amino-9-β-D-ribofuranosylpurine-6-thione; 9-β-D-Ribofuranosylthioguanine; ? |
Molecular Formula | C10H13N5O4S |
Purity | ≥95% |
Target | Nucleoside Antimetabolite/Analog |
Storage | -20°C |
IUPAC Name | 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purine-6-thione |
InChI | InChI=1S/C10H13N5O4S/c11-10-13-7-4(8(20)14-10)12-2-15(7)9-6(18)5(17)3(1-16)19-9/h2-3,5-6,9,16-18H,1H2,(H3,11,13,14,20)/t3-,5-,6-,9-/m1/s1 |
InChIKey | OTDJAMXESTUWLO-UUOKFMHZSA-N |
SMILES | C1=NC2=C(N1C3C(C(C(O3)CO)O)O)NC(=NC2=S)N |