Home
>
Chemical Reagents>Heterocyclic Building Blocks> 2-Amino-6-oxo-1,6-dihydropyrimidine-5-carbaldehyde
For research use only. Not for therapeutic Use.
2-Amino-6-oxo-1,6-dihydropyrimidine-5-carbaldehyde (Cat.No:L003391) is a crucial chemical compound in medicinal chemistry. Its unique structure makes it a valuable scaffold for the synthesis of biologically active molecules. This compound’s significance lies in its role as a key intermediate in the development of pharmaceutical agents, underscoring its importance in modern drug discovery endeavors.
CAS Number | 1402401-43-7 |
Molecular Formula | C5H5N3O2 |
Purity | ≥95% |
IUPAC Name | 2-amino-6-oxo-1H-pyrimidine-5-carbaldehyde |
InChI | InChI=1S/C5H5N3O2/c6-5-7-1-3(2-9)4(10)8-5/h1-2H,(H3,6,7,8,10) |
InChIKey | BBHKKABSLSRNKR-UHFFFAOYSA-N |
SMILES | C1=C(C(=O)NC(=N1)N)C=O |