For research use only. Not for therapeutic Use.
2-Amino-6-(trifluoromethyl)phenol is a fluorinated aromatic compound widely used in pharmaceutical and chemical research. With a trifluoromethyl group at the 6-position, it exhibits unique electronic properties that enhance its reactivity in synthesis and modification processes. This compound serves as an intermediate in the development of agrochemicals, pharmaceuticals, and specialty chemicals. Its versatility makes it valuable in producing fluorinated derivatives and as a building block in complex molecular structures, aiding drug discovery and material science.
CAS Number | 72534-45-3 |
Molecular Formula | C7H6F3NO |
Purity | ≥95% |
IUPAC Name | 2-amino-6-(trifluoromethyl)phenol |
InChI | InChI=1S/C7H6F3NO/c8-7(9,10)4-2-1-3-5(11)6(4)12/h1-3,12H,11H2 |
InChIKey | XOXAZFFGKMIJKE-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C(=C1)N)O)C(F)(F)F |