For research use only. Not for therapeutic Use.
2-Amino-7-(chloromethyl)pteridin-4(1H)-one is a chemical compound featuring a pteridine ring with an amino group at position 2 and a chloromethyl group attached to position 7 of the ring. This compound is of interest in organic synthesis and pharmaceutical research due to its potential as a building block for creating novel molecules with biological activity. Its structure suggests possible interactions with enzymes or receptors, making it valuable in drug discovery efforts targeting pteridine-related pathways or functions.
CAS Number | 1391194-56-1 |
Molecular Formula | C7H6ClN5O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-amino-7-(chloromethyl)-1H-pteridin-4-one |
InChI | InChI=1S/C7H6ClN5O/c8-1-3-2-10-4-5(11-3)12-7(9)13-6(4)14/h2H,1H2,(H3,9,11,12,13,14) |
InChIKey | WHPPYWZHBUBHST-UHFFFAOYSA-N |
SMILES | C1=C(N=C2C(=N1)C(=O)N=C(N2)N)CCl |