For research use only. Not for therapeutic Use.
3′-O-methylguanosine(Cat No.:M066050) is a modified nucleoside found in RNA molecules. It consists of the guanine base linked to a ribose sugar with a methyl group attached to the 3′ carbon position. It plays a role in cellular processes such as protein synthesis and gene expression. In research, it is used as a chemical probe to study RNA structure and function.
Catalog Number | M066050 |
CAS Number | 10300-27-3 |
Molecular Formula | C11H15N5O5 |
Purity | ≥95% |
Storage | 4°C, stored under nitrogen |
IUPAC Name | 2-amino-9-[(2R,3R,4S,5R)-3-hydroxy-5-(hydroxymethyl)-4-methoxyoxolan-2-yl]-1H-purin-6-one |
InChI | InChI=1S/C11H15N5O5/c1-20-7-4(2-17)21-10(6(7)18)16-3-13-5-8(16)14-11(12)15-9(5)19/h3-4,6-7,10,17-18H,2H2,1H3,(H3,12,14,15,19)/t4-,6-,7-,10-/m1/s1 |
InChIKey | UYARPHAXAJAZLU-KQYNXXCUSA-N |
SMILES | COC1C(OC(C1O)N2C=NC3=C2N=C(NC3=O)N)CO |