For research use only. Not for therapeutic Use.
2-Amino-N-quinolin-8-yl-benzenesulfonamide (CAT: M134370) is a chemical compound with potential pharmacological properties. This compound belongs to the class of sulfonamides, which are known for their diverse biological activities. The presence of a quinoline moiety in the structure suggests potential interactions with biological targets. Sulfonamides have been investigated for their antibacterial, antifungal, and antitumor activities, often exerting their effects by inhibiting specific enzymes or interfering with metabolic pathways.
Catalog Number | M134370 |
CAS Number | 16082-64-7 |
Synonyms | 2-AMINO-N-QUINOLINE-8-YL-BENZENESULFONAM |
Molecular Formula | C15H13N3O2S |
Purity | ≥95% |
Target | Apoptosis |
Storage | -20°C |
IUPAC Name | 2-amino-N-quinolin-8-ylbenzenesulfonamide |
InChI | InChI=1S/C15H13N3O2S/c16-12-7-1-2-9-14(12)21(19,20)18-13-8-3-5-11-6-4-10-17-15(11)13/h1-10,18H,16H2 |
InChIKey | NIOOKXAMJQVDGB-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)N)S(=O)(=O)NC2=CC=CC3=C2N=CC=C3 |