For research use only. Not for therapeutic Use.
2-Aminoacridone (Cat No.:R055469) is a chemical compound. It features an acridone core with an amino group at position 2. This compound is utilized in various fields including fluorescent probes, DNA intercalators, and photochemistry. Its fluorescent properties make it valuable as a fluorescent dye for detecting biomolecules and studying cellular processes. Additionally, its potential to intercalate DNA contributes to its role in molecular biology research. The compound’s structure and spectroscopic characteristics are crucial in enabling its applications as a fluorescent probe, enhancing our understanding of biological and chemical systems through sensitive detection methods.
CAS Number | 27918-14-5 |
Synonyms | 2-Amino-9(10H)-acridinone; 2-Amino-9-acridone; |
Molecular Formula | C₁₃H₁₀N₂O |
Purity | ≥95% |
Storage | Keep in dark place,Inert atmosphere,2-8°C |
IUPAC Name | 2-amino-10H-acridin-9-one |
InChI | InChI=1S/C13H10N2O/c14-8-5-6-12-10(7-8)13(16)9-3-1-2-4-11(9)15-12/h1-7H,14H2,(H,15,16) |
InChIKey | PIGCSKVALLVWKU-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C(=O)C3=C(N2)C=CC(=C3)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |