For research use only. Not for therapeutic Use.
Aminoindans (AI) were originally studied as semi-<wbr></wbr>rigid congeners of phenylethylamines, which are psychoactive alkaloids. 2-<wbr></wbr>AI is an aminoindane that serves as the starting point for the synthesis of psychoactive compounds, such as 5,6-<wbr></wbr>methylenedioxy-<wbr></wbr>2-<wbr></wbr>aminoindane. 2-<wbr></wbr>AI itself has modest analgesic and stimulatory properties. This product is intended for forensic applications.
CAS Number | 2338-18-3 |
Synonyms | 2-Indanamine Hydrochloride; (2,3-Dihydro-1H-inden-2-yl)amine Hydrochloride; 2,3-Dihydro-1H-inden-2-amine Hydrochloride; 2-Amino-2,3-dihydro-1H-indene Hydrochloride; 2-Aminoindane Hydrochloride; 2-Indanylamine Hydrochloride; SU 8629 Hydrochloride; |
Molecular Formula | C9H12ClN |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2,3-dihydro-1H-inden-2-amine;hydrochloride |
InChI | InChI=1S/C9H11N.ClH/c10-9-5-7-3-1-2-4-8(7)6-9;/h1-4,9H,5-6,10H2;1H |
InChIKey | XEHNLVMHWYPNEQ-UHFFFAOYSA-N |
SMILES | C1C(CC2=CC=CC=C21)N.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |