For research use only. Not for therapeutic Use.
2-Aminomethyl-1,4-benzodioxane is an organic compound characterized by a benzodioxane structure with an aminoethyl side chain. This compound is significant in medicinal chemistry due to its potential pharmacological properties, often investigated for its role in developing neuroactive agents. Its unique structure enables interactions with various biological targets, making it useful in studies related to central nervous system disorders. Additionally, it serves as a valuable intermediate in synthesizing more complex compounds with therapeutic applications in drug development.
CAS Number | 4442-59-5 |
Synonyms | (2,3-Dihydrobenzo[b][1,4]dioxin-2-yl)methanamine; (±)-2-(Aminomethyl)-1,4-benzodioxane; 1,4-Benzodioxane-2-methylamine; 2-(Aminomethyl)-1,4-benzodioxan; 2-Aminomethyl-1,4-benzodioxane; 2-Aminomethyl-2,3-dihydro-1,4-benzodioxin; Fourneau 946; LP 1; LP |
Molecular Formula | C9H11NO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2,3-dihydro-1,4-benzodioxin-3-ylmethanamine |
InChI | InChI=1S/C9H11NO2/c10-5-7-6-11-8-3-1-2-4-9(8)12-7/h1-4,7H,5-6,10H2 |
InChIKey | JHNURUNMNRSGRO-UHFFFAOYSA-N |
SMILES | C1C(OC2=CC=CC=C2O1)CN |