For research use only. Not for therapeutic Use.
2-Aminomethyl-4-(4-fluorobenzyl)morpholine is a chemical compound featuring a morpholine ring substituted with an aminomethyl group and a 4-fluorobenzyl group. This structure suggests potential utility in pharmaceutical research, particularly in the development of drugs targeting central nervous system disorders. The fluorobenzyl moiety may enhance the compound’s binding affinity and selectivity for certain receptors. Research focuses on its synthesis, pharmacological properties, and potential therapeutic applications in treating conditions such as depression, anxiety, and neurodegenerative diseases.
CAS Number | 112914-13-3 |
Synonyms | 4-[(4-Fluorophenyl)methyl]-2-morpholinemethanamine; |
Molecular Formula | C12H17FN2O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | [4-[(4-fluorophenyl)methyl]morpholin-2-yl]methanamine |
InChI | InChI=1S/C12H17FN2O/c13-11-3-1-10(2-4-11)8-15-5-6-16-12(7-14)9-15/h1-4,12H,5-9,14H2 |
InChIKey | JHSPPBBJOLKJDH-UHFFFAOYSA-N |
SMILES | C1COC(CN1CC2=CC=C(C=C2)F)CN |