For research use only. Not for therapeutic Use.
2-(Aminomethyl)-4-methylpentan-1-ol(Cat No.:L007845), is a chemical compound characterized by a chain of carbon atoms containing a methyl group at the 4-position, an amino group (-NH2) attached to the second carbon, and a hydroxyl group (-OH) at the first carbon.This compound may have applications in organic synthesis, pharmaceutical research, or other scientific fields where unique chemical structures are required for specific purposes. Researchers may study its reactivity, potential biological activities, or utilize it as a building block to design new molecules for various applications.
CAS Number | 1250484-37-7 |
Molecular Formula | C7H17NO |
Purity | ≥95% |
IUPAC Name | 2-(aminomethyl)-4-methylpentan-1-ol |
InChI | InChI=1S/C7H17NO/c1-6(2)3-7(4-8)5-9/h6-7,9H,3-5,8H2,1-2H3 |
InChIKey | JMGASEAIRBNJHL-UHFFFAOYSA-N |
SMILES | CC(C)CC(CN)CO |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |