For research use only. Not for therapeutic Use.
2-Aminophenylboronic acid pinacol ester (Cat No.:M046147) is a chemical compound. It consists of an aminophenyl boronic acid moiety attached to a pinacol ester group. This compound is significant in organic synthesis and medicinal chemistry due to its potential reactivity and applications in Suzuki-Miyaura cross-coupling reactions. Its boronic acid group allows for coupling with various electrophiles, facilitating the creation of diverse molecules. Its role as a boron-containing reagent contributes to the construction of complex structures for drug discovery and chemical research, enhancing the toolkit available for synthesizing biologically active compounds.
CAS Number | 191171-55-8 |
Molecular Formula | C12H18BNO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
InChI | InChI=1S/C12H18BNO2/c1-11(2)12(3,4)16-13(15-11)9-7-5-6-8-10(9)14/h5-8H,14H2,1-4H3 |
InChIKey | ZCJRWQDZPIIYLM-UHFFFAOYSA-N |
SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |