For research use only, not for therapeutic use.
2-Anilino-1,3-thiazole-5-carboxylic acid(Cat No.:L007536), is a chemical compound characterized by a thiazole ring substituted with an aniline group at the 2nd position and a carboxylic acid group at the 5th position. This compound holds significance in medicinal chemistry, serving as a key scaffold in drug discovery. Its unique structure suggests potential biological activities, making it valuable for further exploration in pharmaceutical research. Researchers investigate its reactivity and interactions with biological targets, aiming to design novel drugs.
Catalog Number | L007536 |
CAS Number | 133972-63-1 |
Molecular Formula | C10H8N2O2S |
Purity | ≥95% |
IUPAC Name | 2-anilino-1,3-thiazole-5-carboxylic acid |
InChI | InChI=1S/C10H8N2O2S/c13-9(14)8-6-11-10(15-8)12-7-4-2-1-3-5-7/h1-6H,(H,11,12)(H,13,14) |
InChIKey | JVDCBFYWWGXIRC-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)NC2=NC=C(S2)C(=O)O |