For research use only. Not for therapeutic Use.
2-Azabicyclo[2.2.2]octane hydrochloride(CAT: L029512) is a bicyclic organic compound, also known as quinuclidine hydrochloride. It features a nitrogen atom integrated into a rigid bicyclic structure, which imparts unique chemical and physical properties. The hydrochloride form enhances its solubility in aqueous environments, making it useful in various biological and chemical applications. This compound is frequently employed as a base or a catalyst in organic synthesis, especially in reactions involving alkylation and acylation. It is also of interest in pharmaceutical research due to its structural resemblance to certain alkaloids and its potential as a ligand in medicinal chemistry for receptor targeting.
CAS Number | 5845-15-8 |
Molecular Formula | C7H14ClN |
Purity | ≥95% |
IUPAC Name | 2-azabicyclo[2.2.2]octane;hydrochloride |
InChI | InChI=1S/C7H13N.ClH/c1-3-7-4-2-6(1)5-8-7;/h6-8H,1-5H2;1H |
InChIKey | HPKXYVYKZCJKIP-UHFFFAOYSA-N |