For research use only. Not for therapeutic Use.
2-(Azidomethyl)-3-pyridinecarboxylic acid is an organic compound featuring an azidomethyl group attached to a pyridinecarboxylic acid core. This compound is significant in synthetic chemistry, often utilized in the development of pharmaceuticals and agrochemicals. Its unique structure allows for versatile chemical modifications, making it valuable for creating diverse chemical entities and studying biological activities.
CAS Number | 1700604-18-7 |
Synonyms | 2-(Azidomethyl)nicotinic Acid; |
Molecular Formula | C7H6N4O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-(azidomethyl)pyridine-3-carboxylic acid |
InChI | InChI=1S/C7H6N4O2/c8-11-10-4-6-5(7(12)13)2-1-3-9-6/h1-3H,4H2,(H,12,13) |
InChIKey | RTDBCLUAIVGVLV-UHFFFAOYSA-N |
SMILES | C1=CC(=C(N=C1)CN=[N+]=[N-])C(=O)O |