For research use only. Not for therapeutic Use.
2-(Benzofuran-7-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane(Cat No.:L044659)is a boronic ester derivative commonly used in organic synthesis and pharmaceutical research. Featuring a benzofuran moiety attached to a dioxaborolane ring, this compound serves as a versatile intermediate in Suzuki-Miyaura cross-coupling reactions to form carbon-carbon bonds. Its boron-containing structure allows for efficient reactions, making it ideal for synthesizing complex molecules, including potential drug candidates and fine chemicals. Researchers in medicinal chemistry value this compound for its role in developing novel therapeutics and advanced materials through precise molecular modifications.
CAS Number | 1192755-14-8 |
Molecular Formula | C14H17BO3 |
Purity | ≥95% |
IUPAC Name | 2-(1-benzofuran-7-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
InChI | InChI=1S/C14H17BO3/c1-13(2)14(3,4)18-15(17-13)11-7-5-6-10-8-9-16-12(10)11/h5-9H,1-4H3 |
InChIKey | DNZVVIZYTCIYNY-UHFFFAOYSA-N |
SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3C(=CC=C2)C=CO3 |