For research use only. Not for therapeutic Use.
2-Benzoxazolinone (Cat.No:R070136) is a chemical compound belonging to the benzoxazolinone family. It serves as a versatile building block in organic synthesis, forming the basis for various pharmaceutical and agrochemical compounds. Its unique structure and reactivity make it valuable in the creation of diverse molecules with potential applications in medicine and agriculture.
| Catalog Number | R070136 |
| CAS Number | 59-49-4 |
| Synonyms | 2-Hydroxybenzoxazole |
| Molecular Formula | C7H5NO2 |
| Purity | ≥95% |
| Storage | RT |
| IUPAC Name | 3H-1,3-benzoxazol-2-one |
| InChI | InChI=1S/C7H5NO2/c9-7-8-5-3-1-2-4-6(5)10-7/h1-4H,(H,8,9) |
| InChIKey | ASSKVPFEZFQQNQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=O)O2 |
