For research use only. Not for therapeutic Use.
2-Benzoxazolinone(Cat No.:R070136)is a heterocyclic organic compound with significant biological and chemical importance. Naturally occurring in certain plants as a defensive metabolite, it exhibits antimicrobial, antifungal, and herbicidal properties. Its ability to interfere with cellular processes makes it valuable in agricultural applications, particularly as a bio-herbicide. Additionally, 2-Benzoxazolinone serves as a building block in organic synthesis, contributing to the development of pharmaceuticals and agrochemicals. Its diverse biological activities, including antioxidant and anti-inflammatory potential, highlight its relevance in medicinal and environmental research.
CAS Number | 59-49-4 |
Synonyms | 2-Hydroxybenzoxazole |
Molecular Formula | C7H5NO2 |
Purity | ≥95% |
Target | Parasite |
Storage | RT |
IUPAC Name | 3H-1,3-benzoxazol-2-one |
InChI | InChI=1S/C7H5NO2/c9-7-8-5-3-1-2-4-6(5)10-7/h1-4H,(H,8,9) |
InChIKey | ASSKVPFEZFQQNQ-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)NC(=O)O2 |