Home
>
Chemical Reagents>Heterocyclic Building Blocks> 2-Benzoyl-1-(4-methoxybenzyl)-1,2-dihydroisoquinoline-1-carbonitrile
For research use only. Not for therapeutic Use.
2-Benzoyl-1-(4-methoxybenzyl)-1,2-dihydroisoquinoline-1-carbonitrile(CAT: L000516) is a chemically significant compound with applications in pharmaceutical and organic chemistry. Its action method primarily involves its role as a crucial intermediate for the synthesis of diverse molecules. In pharmaceutical chemistry, this compound serves as a valuable building block for the creation of potential drug candidates and bioactive compounds due to its specific structure.
CAS Number | 61010-37-5 |
Molecular Formula | C25H20N2O2 |
Purity | ≥95% |
IUPAC Name | 2-benzoyl-1-[(4-methoxyphenyl)methyl]isoquinoline-1-carbonitrile |
InChI | InChI=1S/C25H20N2O2/c1-29-22-13-11-19(12-14-22)17-25(18-26)23-10-6-5-7-20(23)15-16-27(25)24(28)21-8-3-2-4-9-21/h2-16H,17H2,1H3 |
InChIKey | UZXCPZNPUTZXHH-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |