For research use only. Not for therapeutic Use.
2-Benzoylbenzofuran-5-carbaldehyde(Cat No.:L021230)is an aromatic compound featuring a benzofuran core with a benzoyl group at the 2-position and an aldehyde group at the 5-position. This compound is valuable in organic synthesis, particularly in the development of pharmaceuticals and fine chemicals. The benzoyl group provides a site for further chemical modifications, while the aldehyde group allows for various condensation reactions, making it a versatile intermediate. Its structure is often utilized in medicinal chemistry to design bioactive molecules with potential therapeutic applications, including anti-inflammatory and anticancer agents.
CAS Number | 120973-72-0 |
Molecular Formula | C16H10O3 |
Purity | ≥95% |
IUPAC Name | 2-benzoyl-1-benzofuran-5-carbaldehyde |
InChI | InChI=1S/C16H10O3/c17-10-11-6-7-14-13(8-11)9-15(19-14)16(18)12-4-2-1-3-5-12/h1-10H |
InChIKey | CLAPHTYIBWGUCN-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C(=O)C2=CC3=C(O2)C=CC(=C3)C=O |