For research use only. Not for therapeutic Use.
2-Benzyl-5-(chloromethyl)-1,3,4-oxadiazole(Cat No.:L006815), is a chemical compound characterized by its molecular structure containing a benzyl group, a chloromethyl group, and an oxadiazole ring. This heterocyclic compound has potential applications in medicinal chemistry and materials science due to its unique structure and reactivity. Researchers often explore its synthesis and diverse chemical transformations to develop new pharmaceuticals, agrochemicals, or materials with specific properties.
Catalog Number | L006815 |
CAS Number | 36646-13-6 |
Molecular Formula | C10H9ClN2O |
Purity | ≥95% |
IUPAC Name | 2-benzyl-5-(chloromethyl)-1,3,4-oxadiazole |
InChI | InChI=1S/C10H9ClN2O/c11-7-10-13-12-9(14-10)6-8-4-2-1-3-5-8/h1-5H,6-7H2 |
InChIKey | DVUSDXWUQFEAQB-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)CC2=NN=C(O2)CCl |