For research use only. Not for therapeutic Use.
2-(Benzylamino)-4-chlorobenzonitrile(Cat No.:L007339), is a chemical compound utilized in various research and industrial applications. This compound falls under the category of benzamides, containing a benzylamine group and a chlorobenzonitrile moiety. Its unique structure makes it valuable in medicinal chemistry, specifically in the development of pharmaceuticals and agrochemicals. Researchers leverage its properties for designing molecules with specific biological activities. The compound’s synthesis and exploration are crucial for understanding its potential applications in drug development and other fields where its chemical properties can be harnessed.
CAS Number | 296259-54-6 |
Molecular Formula | C14H11ClN2 |
Purity | ≥95% |
Storage | Room Temperature |
IUPAC Name | 2-(benzylamino)-4-chlorobenzonitrile |
InChI | InChI=1S/C14H11ClN2/c15-13-7-6-12(9-16)14(8-13)17-10-11-4-2-1-3-5-11/h1-8,17H,10H2 |
InChIKey | PIAZBFBIMPNJHL-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)CNC2=C(C=CC(=C2)Cl)C#N |