For research use only. Not for therapeutic Use.
2-Benzylbenzonitril(Cat No.:L006967), is an organic compound. It is a crystalline solid featuring a benzyl group (C6H5CH2-) attached to a benzonitrile moiety (C6H4-CN). This compound is utilized in organic synthesis as a valuable intermediate, particularly in the preparation of various complex organic molecules and pharmaceutical compounds. Its specific structure provides unique reactivity, making it useful in the development of novel materials and drugs. Researchers leverage its chemical properties to create functionalized molecules, contributing to advancements in medicinal chemistry, material science, and other fields requiring tailored organic compounds.
CAS Number | 56153-61-8 |
Molecular Formula | C14H11N |
Purity | ≥95% |
IUPAC Name | 2-benzylbenzonitrile |
InChI | InChI=1S/C14H11N/c15-11-14-9-5-4-8-13(14)10-12-6-2-1-3-7-12/h1-9H,10H2 |
InChIKey | YCSOWXPYKGFJBX-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)CC2=CC=CC=C2C#N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |