For research use only. Not for therapeutic Use.
2-Benzylidenesuccinic acid (CAT: L000167) is a notable compound with applications in organic chemistry and pharmaceutical research. Its action mechanism involves serving as a key intermediate in various chemical reactions. In organic chemistry, it acts as a versatile building block for the synthesis of pharmaceutical intermediates. This compound is instrumental in the design and development of potential drugs, making it crucial in the pharmaceutical industry. Its utility extends to the field of material chemistry, where it contributes to the creation of functionalized materials for specific applications.
CAS Number | 46427-07-0 |
Molecular Formula | C11H10O4 |
Purity | ≥95% |
IUPAC Name | (2E)-2-benzylidenebutanedioic acid |
InChI | InChI=1S/C11H10O4/c12-10(13)7-9(11(14)15)6-8-4-2-1-3-5-8/h1-6H,7H2,(H,12,13)(H,14,15)/b9-6+ |
InChIKey | KYILORDWJFEQBS-RMKNXTFCSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |