For research use only. Not for therapeutic Use.
2-Benzyloxy-1-bromonaphthalene(Cat No.:L006791). It consists of a naphthalene ring substituted with a bromine atom at the 1-position and a benzyloxy group (-OCH2C6H5) at the 2-position. This compound is important in organic synthesis, serving as a versatile building block for the creation of various organic molecules. Its unique structure allows for diverse chemical transformations, making it valuable in the synthesis of complex pharmaceuticals, agrochemicals, and specialty chemicals. Researchers utilize it as a key intermediate, contributing to advancements in drug discovery and the development of specialized organic compounds.
CAS Number | 41908-23-0 |
Molecular Formula | C17H13BrO |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 1-bromo-2-phenylmethoxynaphthalene |
InChI | InChI=1S/C17H13BrO/c18-17-15-9-5-4-8-14(15)10-11-16(17)19-12-13-6-2-1-3-7-13/h1-11H,12H2 |
InChIKey | VFQRFYFSXMDHMW-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)COC2=C(C3=CC=CC=C3C=C2)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |